2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol structure
|
Common Name | 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 1270526-27-6 | Molecular Weight | 205.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10F3NO |
|---|---|
| Molecular Weight | 205.18 |
| InChIKey | NWPOWASTHFQBCP-UHFFFAOYSA-N |
| SMILES | CC(N)(CO)c1ccc(F)c(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol? |
| A: InChIKey of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol is NWPOWASTHFQBCP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol? |
| A: Molecular formula of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol is C9H10F3NO. |
| Q: What is the Chinese name of 1270526-27-6? |
| A: Chinese name of 1270526-27-6 is 1270526-27-6. |
| Q: What is the molecular weight of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol? |
| A: Molecular weight of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol is 205.18. |
| Q: What is the SMILES notation of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol? |
| A: SMILES notation of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol is CC(N)(CO)c1ccc(F)c(F)c1F. |
| Q: What is the English name of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol? |
| A: The English name of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol is 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol. |
| Q: What is the CAS number of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol? |
| A: CAS number of 2-Amino-2-(2,3,4-trifluorophenyl)propan-1-ol is 1270526-27-6. |