(E)-4-(6-Methoxy-2-naphthalenyl)-3-buten-2-one structure
|
Common Name | (E)-4-(6-Methoxy-2-naphthalenyl)-3-buten-2-one | ||
|---|---|---|---|---|
| CAS Number | 127053-22-9 | Molecular Weight | 226.27000 | |
| Density | 1.119±0.06 g/cm3 (20 ºC 760 Torr) | Boiling Point | N/A | |
| Molecular Formula | C15H14O2 | Melting Point | 120-121 ºC (ethanol ) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(6-methoxy-2-naphthalenyl)but-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119±0.06 g/cm3 (20 ºC 760 Torr) |
|---|---|
| Melting Point | 120-121 ºC (ethanol ) |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 3.45060 |
| InChIKey | ODKROFHKPKRFPM-ONEGZZNKSA-N |
| SMILES | COc1ccc2cc(C=CC(C)=O)ccc2c1 |
| Water Solubility | Practically insoluble (0.043 g/L) (25 ºC) |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
|
Name: Antiinflammatory activity in Wistar rat assessed as inhibition of cotton pellet-induc...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3285897
|
|
Name: Antiinflammatory activity in Wistar rat assessed as inhibition of cotton pellet-induc...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3285901
|
|
Name: Antiinflammatory activity in rat assessed as inhibition of carrageenan-induced paw ed...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3285902
|
| 4-(6-methoxynaphthalen-2-yl)-3-buten-2-one |
| 4-(6'-methoxy-2'-naphthyl)-3-buten-2-one |
| 4-(6'-methoxy-2'-naphthyl)but-3-en-2-one |
| (E)-4-(6-Methoxy-2-naphthalenyl)-3-buten-2-one |