2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol
Modify Date: 2026-07-17 13:50:02
2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol structure
|
Common Name | 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 1270568-93-8 | Molecular Weight | 223.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9F4NO |
|---|---|
| Molecular Weight | 223.17 |
| InChIKey | DSZYBKXXTJZCTJ-UHFFFAOYSA-N |
| SMILES | CC(N)(CO)c1c(F)c(F)cc(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol? |
| A: SMILES notation of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol is CC(N)(CO)c1c(F)c(F)cc(F)c1F. |
| Q: What is the Chinese name of 1270568-93-8? |
| A: Chinese name of 1270568-93-8 is 1270568-93-8. |
| Q: What is the English name of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol? |
| A: The English name of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol is 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol. |
| Q: What is the InChIKey of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol? |
| A: InChIKey of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol is DSZYBKXXTJZCTJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol? |
| A: Molecular weight of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol is 223.17. |
| Q: What is the CAS number of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol? |
| A: CAS number of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol is 1270568-93-8. |
| Q: What is the molecular formula of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol? |
| A: Molecular formula of 2-Amino-2-(2,3,5,6-tetrafluorophenyl)propan-1-ol is C9H9F4NO. |