2-(1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purin-7-yl)ethyl 4-(diethylamino)-4-oxobutyrate
2-(1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purin-7-yl)ethyl 4-(diethylamino)-4-oxobutyrate structure
|
Common Name | 2-(1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purin-7-yl)ethyl 4-(diethylamino)-4-oxobutyrate | ||
|---|---|---|---|---|
| CAS Number | 12712-75-3 | Molecular Weight | 379.41100 | |
| Density | 1.31g/cm3 | Boiling Point | 609.1ºC at 760mmHg | |
| Molecular Formula | C17H25N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.2ºC | |
Summary: 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate (CAS: 12712-75-3, molecular formula: C17H25N5O5, molecular weight: 379.41100) is a compound for research use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 609.1ºC at 760mmHg |
| Molecular Formula | C17H25N5O5 |
| Molecular Weight | 379.41100 |
| Flash Point | 322.2ºC |
| Exact Mass | 379.18600 |
| PSA | 108.43000 |
| Vapour Pressure | 8.83E-15mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | KCFIDDRVZLDJEY-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)CCC(=O)OCCn1cnc2c1c(=O)n(C)c(=O)n2C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
![succinic acid mono-[2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-purin-7-yl)-ethyl ester] Structure](https://image.chemsrc.com/caspic/446/80416-57-5.png)
CAS#:80416-57-5
CAS#:519-37-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| einecs 235-781-9 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate? |
| A: Boiling point of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate is 609.1ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate? |
| A: Polar surface area (PSA) of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate is 108.43000. |
| Q: What are the upstream materials of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate? |
| A: Related upstream materials(CAS) of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate: 80416-57-5;519-37-9. |
| Q: What is the English name of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate? |
| A: The English name of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate. |
| Q: What is the molecular formula of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate? |
| A: Molecular formula of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate is C17H25N5O5. |
| Q: What is the Chinese name of 12712-75-3? |
| A: Chinese name of 12712-75-3 is 12712-75-3. |
| Q: What is the molecular weight of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate? |
| A: Molecular weight of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate is 379.41100. |
| Q: What is the InChIKey of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate? |
| A: InChIKey of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate is KCFIDDRVZLDJEY-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate? |
| A: CAS number of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate is 12712-75-3. |
| Q: What English synonyms does 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate have? |
| A: English synonyms of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 4-(diethylamino)-4-oxobutanoate: einecs 235-781-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |