ethyl N-[[[(E)-1-pyridin-2-ylethylideneamino]carbamothioylamino]carbamothioyl]carbamate structure
|
Common Name | ethyl N-[[[(E)-1-pyridin-2-ylethylideneamino]carbamothioylamino]carbamothioyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 127142-22-7 | Molecular Weight | 340.42400 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H16N6O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[[[(E)-1-pyridin-2-ylethylideneamino]carbamothioylamino]carbamothioyl]carbamate |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C12H16N6O2S2 |
| Molecular Weight | 340.42400 |
| Exact Mass | 340.07800 |
| PSA | 177.93000 |
| LogP | 2.40970 |
| Index of Refraction | 1.657 |
| InChIKey | WYDKFPPQMXFSDR-OVCLIPMQSA-N |
| SMILES | CCOC(=O)NC(=S)NNC(=S)NN=C(C)c1ccccn1 |
|
~71%
ethyl N-[[[(E)-... CAS#:127142-22-7 |
| Literature: Blumenkopf; Harrington; Koble; Bankston; Morrison Jr.; Bigham; Styles; Spector Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2306 - 2314 |
|
~%
ethyl N-[[[(E)-... CAS#:127142-22-7 |
| Literature: Blumenkopf; Harrington; Koble; Bankston; Morrison Jr.; Bigham; Styles; Spector Journal of Medicinal Chemistry, 1992 , vol. 35, # 12 p. 2306 - 2314 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |