8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol
Modify Date: 2026-08-19 10:48:59
![8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol Structure](https://www.chemsrc.com/extcaspic/373/1272110-09-4.png)
8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol structure
|
Common Name | 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol | ||
|---|---|---|---|---|
| CAS Number | 1272110-09-4 | Molecular Weight | 263.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NOS |
|---|---|
| Molecular Weight | 263.4 |
| InChIKey | WENMCAHVZIVJSZ-UHFFFAOYSA-N |
| SMILES | CSc1ccc(CN2C3CCC2CC(O)C3)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol? |
| A: CAS number of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol is 1272110-09-4. |
| Q: What is the English name of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol? |
| A: The English name of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol is 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol. |
| Q: What is the molecular weight of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol? |
| A: Molecular weight of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol is 263.4. |
| Q: What is the molecular formula of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol? |
| A: Molecular formula of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol is C15H21NOS. |
| Q: What is the Chinese name of 1272110-09-4? |
| A: Chinese name of 1272110-09-4 is 1272110-09-4. |
| Q: What is the InChIKey of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol? |
| A: InChIKey of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol is WENMCAHVZIVJSZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol? |
| A: SMILES notation of 8-{[4-(Methylsulfanyl)phenyl]methyl}-8-azabicyclo[3.2.1]octan-3-ol is CSc1ccc(CN2C3CCC2CC(O)C3)cc1. |