2,3,4-trimethyl-3-pentyl diazoacetoacetate
Modify Date: 2026-09-20 13:03:49
2,3,4-trimethyl-3-pentyl diazoacetoacetate structure
|
Common Name | 2,3,4-trimethyl-3-pentyl diazoacetoacetate | ||
|---|---|---|---|---|
| CAS Number | 127236-65-1 | Molecular Weight | 240.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,4-trimethyl-3-pentyl diazoacetoacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20N2O3 |
|---|---|
| Molecular Weight | 240.29900 |
| Exact Mass | 240.14700 |
| PSA | 80.76000 |
| LogP | 1.94116 |
| InChIKey | SLYOIJPVWPYLRY-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=[N+]=[N-])C(=O)OC(C)(C(C)C)C(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:63254-57-9This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: Molecular weight of 2,3,4-trimethyl-3-pentyl diazoacetoacetate is 240.29900. |
| Q: What is the polar surface area (PSA) of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: Polar surface area (PSA) of 2,3,4-trimethyl-3-pentyl diazoacetoacetate is 80.76000. |
| Q: What is the LogP of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: LogP of 2,3,4-trimethyl-3-pentyl diazoacetoacetate is 1.94116. |
| Q: What is the English name of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: The English name of 2,3,4-trimethyl-3-pentyl diazoacetoacetate is 2,3,4-trimethyl-3-pentyl diazoacetoacetate. |
| Q: What are the downstream products of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: Related downstream products(CAS) of 2,3,4-trimethyl-3-pentyl diazoacetoacetate: 63254-57-9. |
| Q: What is the CAS number of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: CAS number of 2,3,4-trimethyl-3-pentyl diazoacetoacetate is 127236-65-1. |
| Q: What is the Chinese name of 127236-65-1? |
| A: Chinese name of 127236-65-1 is 127236-65-1. |
| Q: What is the InChIKey of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: InChIKey of 2,3,4-trimethyl-3-pentyl diazoacetoacetate is SLYOIJPVWPYLRY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: Molecular formula of 2,3,4-trimethyl-3-pentyl diazoacetoacetate is C12H20N2O3. |
| Q: What is the SMILES notation of 2,3,4-trimethyl-3-pentyl diazoacetoacetate? |
| A: SMILES notation of 2,3,4-trimethyl-3-pentyl diazoacetoacetate is CC(=O)C(=[N+]=[N-])C(=O)OC(C)(C(C)C)C(C)C. |