1-(Bromomethyl)-2-fluoro-4-nitrobenzene structure
|
Common Name | 1-(Bromomethyl)-2-fluoro-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 127349-56-8 | Molecular Weight | 234.023 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 304.1±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H5BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.7±23.7 °C | |
| Name | 1-(Bromomethyl)-2-fluoro-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.1±27.0 °C at 760 mmHg |
| Molecular Formula | C7H5BrFNO2 |
| Molecular Weight | 234.023 |
| Flash Point | 137.7±23.7 °C |
| Exact Mass | 232.948761 |
| PSA | 45.82000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | TWQCQFRJJOQBRP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CBr)c(F)c1 |
| HS Code | 2904909090 |
|---|
|
~99%
1-(Bromomethyl)... CAS#:127349-56-8 |
| Literature: PALAU PHARMA, S.A.; SALAS SOLANA, Jorge; ALMANSA ROSALES, Carmen; SOLIVA SOLIVA, Robert; FONTES USTRELL, Montserrat; COMELLES ESPUGA, Josep Patent: WO2010/34740 A1, 2010 ; Location in patent: Page/Page column 68 ; WO 2010/034740 A1 |
|
~85%
1-(Bromomethyl)... CAS#:127349-56-8 |
| Literature: GRÜNENTHAL GMBH; FRANK, Robert; CHRISTOPH, Thomas; SCHIENE, Klaus; DE VRY, Jean; DAMANN, Nils; LESCH, Bernhard; BAHRENBERG, Gregor; SAUNDERS, Derek John; STOCKHAUSEN, Hannelore; KIM, Yong-Soo; KIM, Myeong-Seop; LEE, Jeewoo Patent: WO2013/68461 A1, 2013 ; Location in patent: Page/Page column 124; 125; 126 ; |
|
~%
1-(Bromomethyl)... CAS#:127349-56-8 |
| Literature: GRÜNENTHAL GMBH; FRANK, Robert; CHRISTOPH, Thomas; SCHIENE, Klaus; DE VRY, Jean; DAMANN, Nils; LESCH, Bernhard; BAHRENBERG, Gregor; SAUNDERS, Derek John; STOCKHAUSEN, Hannelore; KIM, Yong-Soo; KIM, Myeong-Seop; LEE, Jeewoo Patent: WO2013/68461 A1, 2013 ; |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-bromomethyl-3-fluoronitrobenzene |
| 2-FLUORO-4'-NITROBENZOPHENONE |
| 1-Bromomethyl-2-fluoro-4-nitro-benzene |
| 1-(Bromomethyl)-2-fluoro-4-nitrobenzene |
| (2-fluorophenyl){4-nitrophenyl}methanone |
| 2-fluoro-4-nitrobenzyl bromide |
| 4-(bromomethyl)-3-fluoro-1-nitrobenzene |
| Benzene, 1-(bromomethyl)-2-fluoro-4-nitro- |