(2-fluoro-4-nitrophenyl)hydrazine structure
|
Common Name | (2-fluoro-4-nitrophenyl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 127350-92-9 | Molecular Weight | 171.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-fluoro-4-nitrophenyl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H6FN3O2 |
|---|---|
| Molecular Weight | 171.12900 |
| Exact Mass | 171.04400 |
| PSA | 83.87000 |
| LogP | 2.31600 |
| InChIKey | HPCGUKRKBLHYJV-UHFFFAOYSA-N |
| SMILES | NNc1ccc([N+](=O)[O-])cc1F |
| HS Code | 2928000090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-fluoro-4-hydrazinonitrobenzene |
| 1-hydrazino-4-nitro-2-fluorobenzene |
| 2-fluoro-4-nitrophenyl hydrazine |