5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one
Modify Date: 2026-07-24 13:09:46
5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one structure
|
Common Name | 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 1273596-93-2 | Molecular Weight | 212.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10F2O2 |
|---|---|
| Molecular Weight | 212.19 |
| InChIKey | YRVYLFXTYPIMRI-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c(F)c1F)CCCC2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one? |
| A: Molecular formula of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one is C11H10F2O2. |
| Q: What is the molecular weight of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one? |
| A: Molecular weight of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one is 212.19. |
| Q: What is the SMILES notation of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one? |
| A: SMILES notation of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one is COc1cc2c(c(F)c1F)CCCC2=O. |
| Q: What is the CAS number of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one? |
| A: CAS number of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one is 1273596-93-2. |
| Q: What is the English name of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one? |
| A: The English name of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one is 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one. |
| Q: What is the InChIKey of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one? |
| A: InChIKey of 5,6-Difluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one is YRVYLFXTYPIMRI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1273596-93-2? |
| A: Chinese name of 1273596-93-2 is 1273596-93-2. |