Neural-Cadherin (76-85) amide (chicken) structure
|
Common Name | Neural-Cadherin (76-85) amide (chicken) | ||
|---|---|---|---|---|
| CAS Number | 127650-08-2 | Molecular Weight | 1050.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H75N17O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Neural-Cadherin (76-85) amide (chicken)Cadherin Peptide, avian is a calcium-dependent glycoprotein. Cadherin Peptide, avian takes part in homophilic cell-cell adhesion and dose-dependently inhibits bovine brain microvessel endothelial cells (BBMECs) adhesion[1]. |
| Name | h-leu-arg-ala-his-ala-val-asp-val-asn-gly-nh2 |
|---|---|
| Synonym | More Synonyms |
| Description | Cadherin Peptide, avian is a calcium-dependent glycoprotein. Cadherin Peptide, avian takes part in homophilic cell-cell adhesion and dose-dependently inhibits bovine brain microvessel endothelial cells (BBMECs) adhesion[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Cadherin Peptide, avian inhibits Ca2+-dependent reaggregation of BBMECs with an IC50 value of 450 μM[1]. Cadherin Peptide, avian (60 min) dose-dependently inhibits BBMEC cell-cell adhesion[1]. |
| References |
| Molecular Formula | C44H75N17O13 |
|---|---|
| Molecular Weight | 1050.17000 |
| Exact Mass | 1049.57000 |
| PSA | 501.98000 |
| LogP | 0.58060 |
| InChIKey | GJLQWIUMNGZLLJ-YZAJHECDSA-N |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(C)C(=O)NC(C(=O)NC(CC(=O)O)C(=O)NC(C(=O)NC(CC(N)=O)C(=O)NCC(N)=O)C(C)C)C(C)C |
| LEU-ARG-ALA-HIS-ALA-VAL-ASP-VAL-ASN-GLY-NH2 |
| Cadherin Peptide,avian |