methyl (2S)-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate
Modify Date: 2025-12-02 13:42:02
![methyl (2S)-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate Structure](https://image.chemsrc.com/caspic/184/127750-57-6.png)
methyl (2S)-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate structure
|
Common Name | methyl (2S)-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate | ||
|---|---|---|---|---|
| CAS Number | 127750-57-6 | Molecular Weight | 261.31600 | |
| Density | 1.09g/cm3 | Boiling Point | 439ºC at 760mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.3ºC | |
| Name | methyl (2S)-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 439ºC at 760mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.31600 |
| Flash Point | 219.3ºC |
| Exact Mass | 261.13600 |
| PSA | 58.89000 |
| LogP | 2.85390 |
| Vapour Pressure | 6.61E-08mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | FPCRRVNOCVWNIW-HBWSCVEGSA-N |
| SMILES | COC(=O)C(NC(=O)C=Cc1ccccc1)C(C)C |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:140-10-3
CAS#:5619-05-6|
Name: Fungitoxic activity against Athelia rolfsii assessed as mycelial growth inhibition at...
Source: ChEMBL
Target: Athelia rolfsii
External Id: CHEMBL3079347
|
|
Name: Fungitoxic activity against Pythium sp. assessed as mycelial growth inhibition at 100...
Source: ChEMBL
Target: Pythium
External Id: CHEMBL3079348
|
Total 2, Current Page 1 of 1
1
| N-cinnamoyl-D,L-valine methyl ester |