methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate
![methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate Structure](https://image.chemsrc.com/caspic/146/127750-58-7.png)
methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate structure
|
Common Name | methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate | ||
|---|---|---|---|---|
| CAS Number | 127750-58-7 | Molecular Weight | 275.34300 | |
| Density | 1.076g/cm3 | Boiling Point | 455.9ºC at 760mmHg | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5ºC | |
Summary: Methyl (2S)-2-[(E)-3-phenylprop-2-enoyl]amino]hexanoate (CAS number: 127750-58-7), molecular formula C16H21NO3, molecular weight 275.34300, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 455.9ºC at 760mmHg |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.34300 |
| Flash Point | 229.5ºC |
| Exact Mass | 275.15200 |
| PSA | 58.89000 |
| LogP | 3.38810 |
| Vapour Pressure | 1.69E-08mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | WQISKJZRURINCI-GETOMWPZSA-N |
| SMILES | CCCCC(NC(=O)C=Cc1ccccc1)C(=O)OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:140-10-3
CAS#:3844-54-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-cinnamoyl-D,L-norleucine methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate? |
| A: LogP of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate is 3.38810. |
| Q: What is the SMILES notation of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate? |
| A: SMILES notation of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate is CCCCC(NC(=O)C=Cc1ccccc1)C(=O)OC. |
| Q: What is the molecular weight of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate? |
| A: Molecular weight of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate is 275.34300. |
| Q: What is the boiling point of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate? |
| A: Boiling point of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate is 455.9ºC at 760mmHg. |
| Q: What are the upstream materials of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate? |
| A: Related upstream materials(CAS) of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate: 140-10-3;3844-54-0. |
| Q: What is the CAS number of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate? |
| A: CAS number of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate is 127750-58-7. |
| Q: What English synonyms does methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate have? |
| A: English synonyms of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate: N-cinnamoyl-D,L-norleucine methyl ester. |
| Q: What is the English name of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate? |
| A: The English name of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate is methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate. |
| Q: What is the Chinese name of 127750-58-7? |
| A: Chinese name of 127750-58-7 is 127750-58-7. |
| Q: What is the InChIKey of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate? |
| A: InChIKey of methyl (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanoate is WQISKJZRURINCI-GETOMWPZSA-N. |