methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate
![methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate Structure](https://image.chemsrc.com/caspic/108/127750-59-8.png)
methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate structure
|
Common Name | methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate | ||
|---|---|---|---|---|
| CAS Number | 127750-59-8 | Molecular Weight | 293.38100 | |
| Density | 1.158g/cm3 | Boiling Point | 515.1ºC at 760mmHg | |
| Molecular Formula | C15H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 515.1ºC at 760mmHg |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.38100 |
| Flash Point | 265.3ºC |
| Exact Mass | 293.10900 |
| PSA | 84.19000 |
| LogP | 2.95100 |
| Vapour Pressure | 1.02E-10mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | WYVOPVXEPMYEBC-XEHSLEBBSA-N |
| SMILES | COC(=O)C(CCSC)NC(=O)C=Cc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:140-10-3
CAS#:2491-18-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Cinnamoyl-L-methionine methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate? |
| A: Polar surface area (PSA) of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate is 84.19000. |
| Q: What English synonyms does methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate have? |
| A: English synonyms of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate: N-Cinnamoyl-L-methionine methyl ester. |
| Q: What is the English name of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate? |
| A: The English name of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate is methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate. |
| Q: What is the SMILES notation of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate? |
| A: SMILES notation of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate is COC(=O)C(CCSC)NC(=O)C=Cc1ccccc1. |
| Q: What is the LogP of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate? |
| A: LogP of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate is 2.95100. |
| Q: What are the upstream materials of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate? |
| A: Related upstream materials(CAS) of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate: 140-10-3;2491-18-1. |
| Q: What is the Chinese name of 127750-59-8? |
| A: Chinese name of 127750-59-8 is 127750-59-8. |
| Q: What is the molecular weight of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate? |
| A: Molecular weight of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate is 293.38100. |
| Q: What is the boiling point of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate? |
| A: Boiling point of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate is 515.1ºC at 760mmHg. |
| Q: What is the InChIKey of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate? |
| A: InChIKey of methyl (2S)-4-methylsulfanyl-2-[[(E)-3-phenylprop-2-enoyl]amino]butanoate is WYVOPVXEPMYEBC-XEHSLEBBSA-N. |