(E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide
(E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide structure
|
Common Name | (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 127750-61-2 | Molecular Weight | 247.33300 | |
| Density | 1.058g/cm3 | Boiling Point | 455.1ºC at 760mmHg | |
| Molecular Formula | C15H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229ºC | |
Summary: (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide, CAS number 127750-61-2, molecular formula C15H21NO2, molecular weight 247.33300, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 455.1ºC at 760mmHg |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.33300 |
| Flash Point | 229ºC |
| Exact Mass | 247.15700 |
| PSA | 52.82000 |
| LogP | 3.06330 |
| Vapour Pressure | 4.51E-09mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | DZDOBDWXGLZYPW-CMDGGOBGSA-N |
| SMILES | CC(C)CC(CO)NC(=O)C=Cc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
![methyl (2S)-4-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanoate Structure](https://image.chemsrc.com/caspic/136/127852-93-1.png)
CAS#:127852-93-1
CAS#:140-10-3
CAS#:6322-53-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Cinnamyl-D,L-leucinol |
| N-cinnamoyl-D,L-leucinol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide? |
| A: Molecular weight of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide is 247.33300. |
| Q: What is the SMILES notation of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide? |
| A: SMILES notation of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide is CC(C)CC(CO)NC(=O)C=Cc1ccccc1. |
| Q: What is the English name of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide? |
| A: The English name of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide is (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide. |
| Q: What is the LogP of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide? |
| A: LogP of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide is 3.06330. |
| Q: What is the Chinese name of 127750-61-2? |
| A: Chinese name of 127750-61-2 is 127750-61-2. |
| Q: What English synonyms does (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide have? |
| A: English synonyms of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide: N-Cinnamyl-D,L-leucinol, N-cinnamoyl-D,L-leucinol. |
| Q: What is the polar surface area (PSA) of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide? |
| A: Polar surface area (PSA) of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide is 52.82000. |
| Q: What is the boiling point of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide? |
| A: Boiling point of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide is 455.1ºC at 760mmHg. |
| Q: What is the molecular formula of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide? |
| A: Molecular formula of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide is C15H21NO2. |
| Q: What is the CAS number of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide? |
| A: CAS number of (E)-N-(1-hydroxy-4-methylpentan-2-yl)-3-phenylprop-2-enamide is 127750-61-2. |