Lobucavir structure
|
Common Name | Lobucavir | ||
|---|---|---|---|---|
| CAS Number | 127759-89-1 | Molecular Weight | 265.268 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 651.8ºC at 760 mmHg | |
| Molecular Formula | C11H15N5O3 | Melting Point | 275-280 ºC | |
| MSDS | N/A | Flash Point | 348ºC | |
| Name | Lobucavir |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 651.8ºC at 760 mmHg |
| Melting Point | 275-280 ºC |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.268 |
| Flash Point | 348ºC |
| Exact Mass | 265.117493 |
| PSA | 130.05000 |
| LogP | -1.24 |
| Vapour Pressure | 7.08E-18mmHg at 25°C |
| Index of Refraction | 1.882 |
| InChIKey | GWFOVSGRNGAGDL-FSDSQADBSA-N |
| SMILES | Nc1nc2c(ncn2C2CC(CO)C2CO)c(=O)[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6H-Purin-6-one, 2-amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1,9-dihydro- |
| C-Oxetanocin-g |
| 2-Amino-9-((1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl)-1H-purin-6(9H)-one |
| 6H-Purin-6-one,2-amino-9-((1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl)-1,9-dihydro |
| (R)-BHCG |
| (+)-9-([1'R,2'R,3'S]-2',3'-bis(Hydroxymethyl)-cyclobutyl)guanine |
| C-Oxt-g |
| 9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutan-1-yl]guanine |
| 2-Amino-9-((1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl)-1,9-dihydro-6H-purin-6-one |
| 2-Amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1,9-dihydro-6H-purin-6-one |
| Carbocyclic oxetanocin G |