5-bromo-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole structure
|
Common Name | 5-bromo-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 127792-80-7 | Molecular Weight | 277.16000 | |
| Density | 1.485g/cm3 | Boiling Point | 449.5ºC at 760mmHg | |
| Molecular Formula | C13H13BrN2 | Melting Point | 190-192ºC | |
| MSDS | N/A | Flash Point | 225.6ºC | |
| Name | 5-bromo-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 449.5ºC at 760mmHg |
| Melting Point | 190-192ºC |
| Molecular Formula | C13H13BrN2 |
| Molecular Weight | 277.16000 |
| Flash Point | 225.6ºC |
| Exact Mass | 276.02600 |
| PSA | 27.82000 |
| LogP | 3.63590 |
| Vapour Pressure | 2.85E-08mmHg at 25°C |
| InChIKey | FCKKUEPMSPRIAO-UHFFFAOYSA-N |
| SMILES | Brc1ccc2[nH]cc(C3=CCNCC3)c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
5-bromo-3-(1,2,... CAS#:127792-80-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 47, # 25 p. 6326 - 6337 |
|
~%
5-bromo-3-(1,2,... CAS#:127792-80-7 |
| Literature: US5846982 A1, ; US 5846982 A |
|
~%
5-bromo-3-(1,2,... CAS#:127792-80-7 |
| Literature: European Journal of Medicinal Chemistry, , vol. 63, p. 484 - 500 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bromotetrahydropyridinylindole |
| 1H-Indole,5-bromo-3-(1,2,3,6-tetrahydro-4-pyridinyl) |
| 5-bromo-3-(1,2,3,6-tetrahydro-4-pyridinyl)-1H-indole |