4-(2-Dimethylaminomethyl-phenylsulfanyl)-benzene-1,3-diol; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 4-(2-Dimethylaminomethyl-phenylsulfanyl)-benzene-1,3-diol; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 127906-28-9 | Molecular Weight | 391.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-Dimethylaminomethyl-phenylsulfanyl)-benzene-1,3-diol; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C19H21NO6S |
|---|---|
| Molecular Weight | 391.43800 |
| Exact Mass | 391.10900 |
| PSA | 143.60000 |
| LogP | 3.02240 |
| InChIKey | WQBXBEXKCHIDCS-WLHGVMLRSA-N |
| SMILES | CN(C)Cc1ccccc1Sc1ccc(O)cc1O.O=C(O)C=CC(=O)O |