4-(2-Methylaminomethyl-phenylsulfanyl)-benzene-1,2-diol; compound with (Z)-but-2-enedioic acid
Modify Date: 2025-10-09 07:29:08
4-(2-Methylaminomethyl-phenylsulfanyl)-benzene-1,2-diol; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 4-(2-Methylaminomethyl-phenylsulfanyl)-benzene-1,2-diol; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 127906-42-7 | Molecular Weight | 377.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-Methylaminomethyl-phenylsulfanyl)-benzene-1,2-diol; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C18H19NO6S |
|---|---|
| Molecular Weight | 377.41200 |
| Exact Mass | 377.09300 |
| PSA | 152.39000 |
| LogP | 3.07110 |
| InChIKey | CFRDXVIPIQMLKR-WLHGVMLRSA-N |
| SMILES | CNCc1ccccc1Sc1ccc(O)c(O)c1.O=C(O)C=CC(=O)O |