Iomazenil structure
|
Common Name | Iomazenil | ||
|---|---|---|---|---|
| CAS Number | 127985-21-1 | Molecular Weight | 411.19400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14IN3O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of IomazenilIomazenil is an antagonist and partial inverse agonist of benzodiazepine and a potential treatment for alcohol abuse. |
| Name | Ethyl 7-iodo-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]ben zodiazepine-3-carboxylate |
|---|
| Molecular Formula | C15H14IN3O3 |
|---|---|
| Molecular Weight | 411.19400 |
| Exact Mass | 411.00800 |
| PSA | 64.43000 |
| LogP | 2.17710 |
| InChIKey | FRIZVHMAECRUBR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ncn2c1CN(C)C(=O)c1c(I)cccc1-2 |
| RIDADR | NONH for all modes of transport |
|---|