4,5-dichloro-1-nitroanthraquinone structure
|
Common Name | 4,5-dichloro-1-nitroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 128-96-1 | Molecular Weight | 322.10000 | |
| Density | 1.653g/cm3 | Boiling Point | 535.1ºC at 760mmHg | |
| Molecular Formula | C14H5Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.4ºC | |
| Name | 4,5-dichloro-1-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.653g/cm3 |
|---|---|
| Boiling Point | 535.1ºC at 760mmHg |
| Molecular Formula | C14H5Cl2NO4 |
| Molecular Weight | 322.10000 |
| Flash Point | 277.4ºC |
| Exact Mass | 320.96000 |
| PSA | 79.96000 |
| LogP | 4.20020 |
| Vapour Pressure | 1.58E-11mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | KBVOCALKCZCXKK-UHFFFAOYSA-N |
| SMILES | O=C1c2c(Cl)cccc2C(=O)c2c([N+](=O)[O-])ccc(Cl)c21 |
| HS Code | 2914700090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 9,10-Anthracenedione,4,5-dichloro-1-nitro |
| 4,5-dichloro-1-nitro-anthraquinone |
| 1-Nitro-4,5-dichloroanthraquinone |
| EINECS 204-923-1 |
| 4,5-Dichlor-1-nitro-anthrachinon |
| ANTHRAQUINONE,4,5-DICHLORO-1-NITRO |