N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide
Modify Date: 2026-07-03 17:08:09
amino}acetamide Structure](https://www.chemsrc.com/extcaspic/179/1280903-99-2.png)
N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide structure
|
Common Name | N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide | ||
|---|---|---|---|---|
| CAS Number | 1280903-99-2 | Molecular Weight | 331.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H29N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H29N3O2 |
|---|---|
| Molecular Weight | 331.5 |
| InChIKey | JIXPZCCRSLUOQH-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(C)N(C)CC(=O)NC(C)(C#N)C(C)C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide? |
| A: Molecular formula of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide is C19H29N3O2. |
| Q: What is the SMILES notation of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide? |
| A: SMILES notation of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide is COc1ccc(CC(C)N(C)CC(=O)NC(C)(C#N)C(C)C)cc1. |
| Q: What is the InChIKey of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide? |
| A: InChIKey of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide is JIXPZCCRSLUOQH-UHFFFAOYSA-N. |
| Q: What is the English name of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide? |
| A: The English name of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide is N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide. |
| Q: What is the CAS number of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide? |
| A: CAS number of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide is 1280903-99-2. |
| Q: What is the Chinese name of 1280903-99-2? |
| A: Chinese name of 1280903-99-2 is 1280903-99-2. |
| Q: What is the molecular weight of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide? |
| A: Molecular weight of N-(1-cyano-1,2-dimethylpropyl)-2-{[1-(4-methoxyphenyl)propan-2-yl](methyl)amino}acetamide is 331.5. |