4-amino-3-((tert-butoxycarbonyl)amino)benzoic acid structure
|
Common Name | 4-amino-3-((tert-butoxycarbonyl)amino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1282523-83-4 | Molecular Weight | 252.266 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 378.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4±26.5 °C | |
| Name | 4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.0±37.0 °C at 760 mmHg |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.266 |
| Flash Point | 182.4±26.5 °C |
| Exact Mass | 252.111008 |
| PSA | 105.14000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | IWQZDVMJSKYZEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)C(=O)O)N |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| sc4310 |
| Benzoic acid, 4-amino-3-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 4-Amino-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid |