3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione
Modify Date: 2026-08-15 10:03:23
![3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione Structure](https://image.chemsrc.com/caspic/384/128352-81-8.png)
3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione structure
|
Common Name | 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 128352-81-8 | Molecular Weight | 374.52200 | |
| Density | 1.32g/cm3 | Boiling Point | 575.9ºC at 760 mmHg | |
| Molecular Formula | C22H18N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 575.9ºC at 760 mmHg |
| Molecular Formula | C22H18N2S2 |
| Molecular Weight | 374.52200 |
| Flash Point | 302.1ºC |
| Exact Mass | 374.09100 |
| PSA | 78.15000 |
| LogP | 6.36230 |
| Vapour Pressure | 2.9E-13mmHg at 25°C |
| Index of Refraction | 1.734 |
| InChIKey | LYWLZVCQLUCJGE-UHFFFAOYSA-N |
| SMILES | S=c1nc2sc3c(c2c(-c2ccccc2)n1-c1ccccc1)CCCC3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
![3-Benzoyl-2-isothiocyanato-4,5,6,7-tetrahydrobenzo[b]thiophene Structure](https://image.chemsrc.com/caspic/122/119934-31-5.png)
CAS#:119934-31-5
CAS#:4651-72-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: InChIKey of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is LYWLZVCQLUCJGE-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Polar surface area (PSA) of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 78.15000. |
| Q: What is the SMILES notation of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: SMILES notation of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is S=c1nc2sc3c(c2c(-c2ccccc2)n1-c1ccccc1)CCCC3. |
| Q: What is the LogP of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: LogP of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 6.36230. |
| Q: What is the boiling point of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Boiling point of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 575.9ºC at 760 mmHg. |
| Q: What is the Chinese name of 128352-81-8? |
| A: Chinese name of 128352-81-8 is 128352-81-8. |
| Q: What are the upstream materials of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Related upstream materials(CAS) of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione: 119934-31-5;4651-72-3. |
| Q: What is the English name of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: The English name of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione. |
| Q: What is the molecular weight of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Molecular weight of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is 374.52200. |
| Q: What is the molecular formula of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione? |
| A: Molecular formula of 3,4-diphenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione is C22H18N2S2. |