ethyl 1-cyanoindolizine-3-carboxylate
ethyl 1-cyanoindolizine-3-carboxylate structure
|
Common Name | ethyl 1-cyanoindolizine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 128352-98-7 | Molecular Weight | 214.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 1-cyanoindolizine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10N2O2 |
|---|---|
| Molecular Weight | 214.22000 |
| Exact Mass | 214.07400 |
| PSA | 54.50000 |
| LogP | 1.98768 |
| InChIKey | UDOULSMPLYHFJV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C#N)c2ccccn12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:60838-50-8
CAS#:17282-40-5![3-amino-1-cyano-4H-pyrido[1,2-a]pyridin-4-one Structure](https://image.chemsrc.com/caspic/368/188816-65-1.png)
CAS#:188816-65-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Indolizinecarboxylic acid,1-cyano-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of ethyl 1-cyanoindolizine-3-carboxylate? |
| A: Related upstream materials(CAS) of ethyl 1-cyanoindolizine-3-carboxylate: 60838-50-8;17282-40-5;188816-65-1. |
| Q: What is the English name of ethyl 1-cyanoindolizine-3-carboxylate? |
| A: The English name of ethyl 1-cyanoindolizine-3-carboxylate is ethyl 1-cyanoindolizine-3-carboxylate. |
| Q: What is the SMILES notation of ethyl 1-cyanoindolizine-3-carboxylate? |
| A: SMILES notation of ethyl 1-cyanoindolizine-3-carboxylate is CCOC(=O)c1cc(C#N)c2ccccn12. |
| Q: What is the Chinese name of 128352-98-7? |
| A: Chinese name of 128352-98-7 is 128352-98-7. |
| Q: What is the molecular formula of ethyl 1-cyanoindolizine-3-carboxylate? |
| A: Molecular formula of ethyl 1-cyanoindolizine-3-carboxylate is C12H10N2O2. |
| Q: What is the molecular weight of ethyl 1-cyanoindolizine-3-carboxylate? |
| A: Molecular weight of ethyl 1-cyanoindolizine-3-carboxylate is 214.22000. |
| Q: What is the InChIKey of ethyl 1-cyanoindolizine-3-carboxylate? |
| A: InChIKey of ethyl 1-cyanoindolizine-3-carboxylate is UDOULSMPLYHFJV-UHFFFAOYSA-N. |
| Q: What English synonyms does ethyl 1-cyanoindolizine-3-carboxylate have? |
| A: English synonyms of ethyl 1-cyanoindolizine-3-carboxylate: 3-Indolizinecarboxylic acid,1-cyano-,ethyl ester. |
| Q: What is the polar surface area (PSA) of ethyl 1-cyanoindolizine-3-carboxylate? |
| A: Polar surface area (PSA) of ethyl 1-cyanoindolizine-3-carboxylate is 54.50000. |
| Q: What is the LogP of ethyl 1-cyanoindolizine-3-carboxylate? |
| A: LogP of ethyl 1-cyanoindolizine-3-carboxylate is 1.98768. |