Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl)
Modify Date: 2026-07-04 08:30:56
![Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) Structure](https://www.chemsrc.com/extcaspic/453/1283717-78-1.png)
Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) structure
|
Common Name | Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) | ||
|---|---|---|---|---|
| CAS Number | 1283717-78-1 | Molecular Weight | 238.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11FN2O3 |
|---|---|
| Molecular Weight | 238.21 |
| InChIKey | ZLNWPUCWYTYEIR-UHFFFAOYSA-N |
| SMILES | CC(C)(O)c1ccn2c(C(=O)O)cnc2c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl)? |
| A: CAS number of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) is 1283717-78-1. |
| Q: What is the SMILES notation of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl)? |
| A: SMILES notation of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) is CC(C)(O)c1ccn2c(C(=O)O)cnc2c1F. |
| Q: What is the molecular weight of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl)? |
| A: Molecular weight of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) is 238.21. |
| Q: What is the English name of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl)? |
| A: The English name of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) is Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl). |
| Q: What is the Chinese name of 1283717-78-1? |
| A: Chinese name of 1283717-78-1 is 1283717-78-1. |
| Q: What is the InChIKey of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl)? |
| A: InChIKey of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) is ZLNWPUCWYTYEIR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl)? |
| A: Molecular formula of Imidazo[1,2-a]pyridine-3-carboxylic acid, 8-fluoro-7-(1-hydroxy-1-methylethyl) is C11H11FN2O3. |