3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine
Modify Date: 2025-09-09 18:09:59
![3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine Structure](https://www.chemsrc.com/extcaspic/173/1283721-01-6.png)
3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine structure
|
Common Name | 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1283721-01-6 | Molecular Weight | 217.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F3NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6F3NS |
|---|---|
| Molecular Weight | 217.21 |
| InChIKey | ZYIVBOMGPNBRAD-UHFFFAOYSA-N |
| SMILES | Cc1csc2ccc(C(F)(F)F)nc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine? |
| A: Molecular formula of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine is C9H6F3NS. |
| Q: What is the SMILES notation of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine? |
| A: SMILES notation of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine is Cc1csc2ccc(C(F)(F)F)nc12. |
| Q: What is the CAS number of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine? |
| A: CAS number of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine is 1283721-01-6. |
| Q: What is the Chinese name of 1283721-01-6? |
| A: Chinese name of 1283721-01-6 is 1283721-01-6. |
| Q: What is the InChIKey of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine? |
| A: InChIKey of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine is ZYIVBOMGPNBRAD-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine? |
| A: The English name of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine is 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine. |
| Q: What is the molecular weight of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine? |
| A: Molecular weight of 3-Methyl-5-(trifluoromethyl)thieno[3,2-b]pyridine is 217.21. |