CY3.5 structure
|
Common Name | CY3.5 | ||
|---|---|---|---|---|
| CAS Number | 1284240-77-2 | Molecular Weight | 891.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H42N2O14S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CY3.5Cy3.5 is a fluorescent dye that can be used to label antibodies[1]. |
| Name | 2-(3-(3-(5-carboxypentyl)-1,1-dimethyl-6,8-disulfo-1,3-dihydro-2H-benzo[e]indol-2-ylidene)prop-1-en-1-yl)-3-ethyl-1,1-dimethyl-8-sulfo-1H-benzo[e]indol-3-ium-6-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Cy3.5 is a fluorescent dye that can be used to label antibodies[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C39H42N2O14S4 |
|---|---|
| Molecular Weight | 891.02 |
| Exact Mass | 890.15200 |
| PSA | 297.38000 |
| LogP | 10.26320 |
| InChIKey | SMRJSACRIKPVSW-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC=CC2=[N+](CCCCCC(=O)O)c3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4c3C2(C)C)C(C)(C)c2c1ccc1c(S(=O)(=O)O)cc(S(=O)(=O)[O-])cc21 |
| MFCD30470671 |