Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo
Modify Date: 2026-09-27 11:53:59
Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo structure
|
Common Name | Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo | ||
|---|---|---|---|---|
| CAS Number | 1284422-44-1 | Molecular Weight | 237.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15N3OS |
|---|---|
| Molecular Weight | 237.32 |
| InChIKey | FTFVXNMFEBIZPF-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)NCc1ccncc1)C(N)=S |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo? |
| A: InChIKey of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo is FTFVXNMFEBIZPF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo? |
| A: Molecular weight of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo is 237.32. |
| Q: What is the CAS number of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo? |
| A: CAS number of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo is 1284422-44-1. |
| Q: What is the Chinese name of 1284422-44-1? |
| A: Chinese name of 1284422-44-1 is 1284422-44-1. |
| Q: What is the molecular formula of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo? |
| A: Molecular formula of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo is C11H15N3OS. |
| Q: What is the SMILES notation of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo? |
| A: SMILES notation of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo is CC(CC(=O)NCc1ccncc1)C(N)=S. |
| Q: What is the English name of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo? |
| A: The English name of Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo is Butanamide, 4-amino-3-methyl-N-(4-pyridinylmethyl)-4-thioxo. |