4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine structure
|
Common Name | 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 128554-92-7 | Molecular Weight | 341.42700 | |
| Density | 1.303g/cm3 | Boiling Point | 517ºC at 760mmHg | |
| Molecular Formula | C18H19N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 517ºC at 760mmHg |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.42700 |
| Flash Point | 266.5ºC |
| Exact Mass | 341.12000 |
| PSA | 89.33000 |
| LogP | 5.99550 |
| Vapour Pressure | 8.53E-11mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | KWNLYGVTFCMQRP-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(Nc2c([N+](=O)[O-])sc3ccccc23)cc1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: Molecular weight of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is 341.42700. |
| Q: What is the polar surface area (PSA) of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: Polar surface area (PSA) of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is 89.33000. |
| Q: What is the LogP of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: LogP of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is 5.99550. |
| Q: What is the molecular formula of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: Molecular formula of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is C18H19N3O2S. |
| Q: What is the SMILES notation of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: SMILES notation of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is CCN(CC)c1ccc(Nc2c([N+](=O)[O-])sc3ccccc23)cc1. |
| Q: What is the Chinese name of 128554-92-7? |
| A: Chinese name of 128554-92-7 is 128554-92-7. |
| Q: What is the InChIKey of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: InChIKey of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is KWNLYGVTFCMQRP-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: CAS number of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is 128554-92-7. |
| Q: What is the English name of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: The English name of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine. |
| Q: What is the boiling point of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine? |
| A: Boiling point of 4-N,4-N-diethyl-1-N-(2-nitro-1-benzothiophen-3-yl)benzene-1,4-diamine is 517ºC at 760mmHg. |