2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide
Modify Date: 2025-11-03 20:11:44
![2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide Structure](https://www.chemsrc.com/extcaspic/475/1286732-29-3.png)
2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide structure
|
Common Name | 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide | ||
|---|---|---|---|---|
| CAS Number | 1286732-29-3 | Molecular Weight | 237.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16FNO2 |
|---|---|
| Molecular Weight | 237.27 |
| InChIKey | UXXUHKIDIFHGJC-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(F)cc1)NCC1(CO)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide? |
| A: InChIKey of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide is UXXUHKIDIFHGJC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1286732-29-3? |
| A: Chinese name of 1286732-29-3 is 1286732-29-3. |
| Q: What is the molecular formula of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide? |
| A: Molecular formula of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide is C13H16FNO2. |
| Q: What is the CAS number of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide? |
| A: CAS number of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide is 1286732-29-3. |
| Q: What is the molecular weight of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide? |
| A: Molecular weight of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide is 237.27. |
| Q: What is the English name of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide? |
| A: The English name of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide is 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide. |
| Q: What is the SMILES notation of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide? |
| A: SMILES notation of 2-(4-fluorophenyl)-N-{[1-(hydroxymethyl)cyclopropyl]methyl}acetamide is O=C(Cc1ccc(F)cc1)NCC1(CO)CC1. |