3’-Hydroxy Repaglinide Ethyl Ester(Mixture of Diastereomers) structure
|
Common Name | 3’-Hydroxy Repaglinide Ethyl Ester(Mixture of Diastereomers) | ||
|---|---|---|---|---|
| CAS Number | 1286972-50-6 | Molecular Weight | 496.638 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 698.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C29H40N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 376.0±31.5 °C | |
| Name | Ethyl 2-ethoxy-4-[2-({1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl}amino)-2-oxoethyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 698.2±55.0 °C at 760 mmHg |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.638 |
| Flash Point | 376.0±31.5 °C |
| Exact Mass | 496.293732 |
| LogP | 4.02 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | MQKJIODGPALHCU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(CC(=O)NC(CC(C)C)c2ccccc2N2CCCC(O)C2)cc1OCC |
| Ethyl 2-ethoxy-4-[2-({1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl}amino)-2-oxoethyl]benzoate |
| Benzoic acid, 2-ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]-, ethyl ester |