HMBR
Modify Date: 2025-08-25 20:02:11
HMBR structure
|
Common Name | HMBR | ||
|---|---|---|---|---|
| CAS Number | 1287651-36-8 | Molecular Weight | 251.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HMBRHMBR, an analog bearing an additional methyl group on the aromatic ring, is nonfluorescent by itself, but it fluoresces yellow light upon blue-light excitation when bound to Y-FAST. HMBR is nontoxic for zebrafish embryos. cell-permeant[1]. |
| Name | HMBR |
|---|
| Description | HMBR, an analog bearing an additional methyl group on the aromatic ring, is nonfluorescent by itself, but it fluoresces yellow light upon blue-light excitation when bound to Y-FAST. HMBR is nontoxic for zebrafish embryos. cell-permeant[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H9NO2S2 |
|---|---|
| Molecular Weight | 251.32 |
| InChIKey | WUYJNCRVBZWAOK-UITAMQMPSA-N |
| SMILES | Cc1cc(C=C2SC(=S)NC2=O)ccc1O |