Suc-Ala-Glu-Pro-Phe-pNA structure
|
Common Name | Suc-Ala-Glu-Pro-Phe-pNA | ||
|---|---|---|---|---|
| CAS Number | 128802-76-6 | Molecular Weight | 682.678 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1165.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C32H38N6O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 658.6±34.3 °C | |
Use of Suc-Ala-Glu-Pro-Phe-pNASuc-Ala-Glu-Pro-Phe-pNA (Suc-AEPF-pNA) is a chromogenic substrate for the peptidylprolyl isomerase Pin1. Suc-Ala-Glu-Pro-Phe-pNA can be used to evaluate the inhibitory effect of the target compound on Pin1, and catalytic activity of Pin1, etc[1][2]. |
| Name | N-(3-Carboxypropanoyl)-L-alanyl-L-α-glutamyl-L-prolyl-N-(4-nitrophenyl)-L-phenylalaninamide |
|---|---|
| Synonym | More Synonyms |
| Description | Suc-Ala-Glu-Pro-Phe-pNA (Suc-AEPF-pNA) is a chromogenic substrate for the peptidylprolyl isomerase Pin1. Suc-Ala-Glu-Pro-Phe-pNA can be used to evaluate the inhibitory effect of the target compound on Pin1, and catalytic activity of Pin1, etc[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1165.4±65.0 °C at 760 mmHg |
| Molecular Formula | C32H38N6O11 |
| Molecular Weight | 682.678 |
| Flash Point | 658.6±34.3 °C |
| Exact Mass | 682.259827 |
| LogP | 2.19 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | NXIHRDNJQWUSLK-KMAVCZJNSA-N |
| SMILES | CC(NC(=O)CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| N-(3-Carboxypropanoyl)-L-alanyl-L-α-glutamyl-L-prolyl-N-(4-nitrophenyl)-L-phenylalaninamide |
| MFCD00238367 |
| L-Phenylalaninamide, N-(3-carboxy-1-oxopropyl)-L-alanyl-L-α-glutamyl-L-prolyl-N-(4-nitrophenyl)- |
| Suc-Ala-Glu-Pro-Phe-pNA |