1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate
Modify Date: 2025-10-23 12:02:19
1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate structure
|
Common Name | 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 1289178-54-6 | Molecular Weight | 367.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H29N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H29N3O2 |
|---|---|
| Molecular Weight | 367.5 |
| InChIKey | UTIXCFWOKAICCG-UHFFFAOYSA-N |
| SMILES | NCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Displacement of [3H]-N-methyl-scopolamine from human muscarinic M3 receptor after 6 h...
Source: ChEMBL
Target: Muscarinic acetylcholine receptor M3
External Id: CHEMBL1686736
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate? |
| A: SMILES notation of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate is NCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1. |
| Q: What is the InChIKey of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate? |
| A: InChIKey of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate is UTIXCFWOKAICCG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate? |
| A: Molecular formula of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate is C22H29N3O2. |
| Q: What is the molecular weight of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate? |
| A: Molecular weight of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate is 367.5. |
| Q: What is the Chinese name of 1289178-54-6? |
| A: Chinese name of 1289178-54-6 is 1289178-54-6. |
| Q: What is the English name of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate? |
| A: The English name of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate is 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate. |
| Q: What is the CAS number of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate? |
| A: CAS number of 1-(4-Aminobutyl)piperidin-4-yl biphenyl-2-ylcarbamate is 1289178-54-6. |