1-Naphthalenesulfonicacid, 8-[(4-methylphenyl)amino]
Modify Date: 2025-08-25 17:12:18
![1-Naphthalenesulfonicacid, 8-[(4-methylphenyl)amino] Structure](https://image.chemsrc.com/caspic/007/129-90-8.png)
1-Naphthalenesulfonicacid, 8-[(4-methylphenyl)amino] structure
|
Common Name | 1-Naphthalenesulfonicacid, 8-[(4-methylphenyl)amino] | ||
|---|---|---|---|---|
| CAS Number | 129-90-8 | Molecular Weight | 313.37100 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-(4-methylanilino)naphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.37100 |
| Exact Mass | 313.07700 |
| PSA | 74.78000 |
| LogP | 5.29230 |
| Index of Refraction | 1.692 |
| InChIKey | FDXOYIGOUGEQBC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cccc3cccc(S(=O)(=O)O)c23)cc1 |
| HS Code | 2921499090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:106-49-0
CAS#:82-75-7| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 204-968-7 |
| 8-p-toluidino-naphthalene-1-sulfonic acid |
| 8-p-Toluidino-1-naphthalenesulfonic acid |
| Tolyl Peri acid |
| 1-Naphthalenesulfonic acid,8-p-toluidino |
| 8-p-Toluidino-naphthalin-1-sulfonsaeure |