Aurantio-obtusin beta-D-glucoside structure
|
Common Name | Aurantio-obtusin beta-D-glucoside | ||
|---|---|---|---|---|
| CAS Number | 129025-96-3 | Molecular Weight | 492.42900 | |
| Density | 1.602g/cm3 | Boiling Point | 845ºC at 760mmHg | |
| Molecular Formula | C23H24O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.1ºC | |
Use of Aurantio-obtusin beta-D-glucosideAurantio-obtusin β-D-glucoside (Glucoaurantio-obtusin), isolated from Cassiae Semen (seeds of Cassia tora), is a glucoside of aurantio-obtusin[1]. |
| Name | aurantio-obtusin β-D-glucoside |
|---|---|
| Synonym | More Synonyms |
| Description | Aurantio-obtusin β-D-glucoside (Glucoaurantio-obtusin), isolated from Cassiae Semen (seeds of Cassia tora), is a glucoside of aurantio-obtusin[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.602g/cm3 |
|---|---|
| Boiling Point | 845ºC at 760mmHg |
| Molecular Formula | C23H24O12 |
| Molecular Weight | 492.42900 |
| Flash Point | 292.1ºC |
| Exact Mass | 492.12700 |
| PSA | 192.44000 |
| Vapour Pressure | 2.4E-30mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | LQYQYAJWKXDTHR-PHVGODQESA-N |
| SMILES | COc1c(OC2OC(CO)C(O)C(O)C2O)cc2c(c1O)C(=O)c1c(cc(C)c(O)c1OC)C2=O |
| Storage condition | 2-8°C |
| 1,7-dihydroxy-2,8-dimethoxy-6-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione |
| aurantio-obtusin beta-D-glucoside |
| Gluco-Aurantioobtusin |