1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl
Modify Date: 2026-07-03 19:47:25
1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl structure
|
Common Name | 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 1291487-35-8 | Molecular Weight | 222.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14N2OS |
|---|---|
| Molecular Weight | 222.31 |
| InChIKey | VUQSPYWUTXTIHU-UHFFFAOYSA-N |
| SMILES | COC(c1cccs1)c1c(C)n[nH]c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl? |
| A: The English name of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl is 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl. |
| Q: What is the InChIKey of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl? |
| A: InChIKey of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl is VUQSPYWUTXTIHU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl? |
| A: CAS number of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl is 1291487-35-8. |
| Q: What is the molecular weight of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl? |
| A: Molecular weight of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl is 222.31. |
| Q: What is the Chinese name of 1291487-35-8? |
| A: Chinese name of 1291487-35-8 is 1291487-35-8. |
| Q: What is the molecular formula of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl? |
| A: Molecular formula of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl is C11H14N2OS. |
| Q: What is the SMILES notation of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl? |
| A: SMILES notation of 1H-Pyrazole, 4-(methoxy-2-thienylmethyl)-3,5-dimethyl is COC(c1cccs1)c1c(C)n[nH]c1C. |