7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl)
Modify Date: 2025-09-09 17:40:45
7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) structure
|
Common Name | 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 1291493-84-9 | Molecular Weight | 309.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClNO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12ClNO4S2 |
|---|---|
| Molecular Weight | 309.8 |
| InChIKey | FTYGRWOOCVQRGG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCCc2ccc(S(=O)(=O)Cl)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl)? |
| A: The English name of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) is 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl). |
| Q: What is the SMILES notation of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl)? |
| A: SMILES notation of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) is CS(=O)(=O)N1CCCc2ccc(S(=O)(=O)Cl)cc21. |
| Q: What is the InChIKey of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl)? |
| A: InChIKey of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) is FTYGRWOOCVQRGG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1291493-84-9? |
| A: Chinese name of 1291493-84-9 is 1291493-84-9. |
| Q: What is the CAS number of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl)? |
| A: CAS number of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) is 1291493-84-9. |
| Q: What is the molecular formula of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl)? |
| A: Molecular formula of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) is C10H12ClNO4S2. |
| Q: What is the molecular weight of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl)? |
| A: Molecular weight of 7-Quinolinesulfonyl chloride, 1,2,3,4-tetrahydro-1-(methylsulfonyl) is 309.8. |