Boscialin structure
|
Common Name | Boscialin | ||
|---|---|---|---|---|
| CAS Number | 129277-03-8 | Molecular Weight | 226.31200 | |
| Density | 1.094g/cm3 | Boiling Point | 351.8ºC at 760 mmHg | |
| Molecular Formula | C13H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.8ºC | |
Use of BoscialinBoscialin ((-)-Boscialin) can be isolated from the leaves of the African medicinal plant Boscia salicifolia[1]. |
| Name | (E)-4-[(1S,4S,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
|---|
| Description | Boscialin ((-)-Boscialin) can be isolated from the leaves of the African medicinal plant Boscia salicifolia[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760 mmHg |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.31200 |
| Flash Point | 180.8ºC |
| Exact Mass | 226.15700 |
| PSA | 57.53000 |
| LogP | 1.67970 |
| Vapour Pressure | 2.35E-06mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | CWLKAPCFJXJCEO-SGEPYOGPSA-N |
| SMILES | CC(=O)C=CC1(O)C(C)CC(O)CC1(C)C |