1-<2-chloro-3-(trifluoromethyl)phenyl>ethanone structure
|
Common Name | 1-<2-chloro-3-(trifluoromethyl)phenyl>ethanone | ||
|---|---|---|---|---|
| CAS Number | 129322-82-3 | Molecular Weight | 222.59200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6ClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-<2-chloro-3-(trifluoromethyl)phenyl>ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6ClF3O |
|---|---|
| Molecular Weight | 222.59200 |
| Exact Mass | 222.00600 |
| PSA | 17.07000 |
| LogP | 3.56140 |
| InChIKey | IQGXHYRICLUDTC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(C(F)(F)F)c1Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2'-chloro-3'-(trifluoromethyl)acetophenone |