1-(Benzyloxycarbonyl)piperazine-2-carboxylic acid structure
|
Common Name | 1-(Benzyloxycarbonyl)piperazine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 129365-24-8 | Molecular Weight | 264.27700 | |
| Density | 1.294g/cm3 | Boiling Point | 465.1ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.1ºC | |
| Name | 1-((Benzyloxy)carbonyl)piperazine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 465.1ºC at 760 mmHg |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.27700 |
| Flash Point | 235.1ºC |
| Exact Mass | 264.11100 |
| PSA | 78.87000 |
| LogP | 0.94830 |
| Vapour Pressure | 1.88E-09mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | KEIDRYXLYCWVSP-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CNCCN1C(=O)OCc1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-phenylmethoxycarbonylpiperazine-2-carboxylic acid |