6-[(4-chlorophenyl)methoxy]-7H-purin-2-amine
Modify Date: 2025-09-08 23:04:32
![6-[(4-chlorophenyl)methoxy]-7H-purin-2-amine Structure](https://image.chemsrc.com/caspic/006/129409-64-9.png)
6-[(4-chlorophenyl)methoxy]-7H-purin-2-amine structure
|
Common Name | 6-[(4-chlorophenyl)methoxy]-7H-purin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 129409-64-9 | Molecular Weight | 275.69400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[(4-chlorophenyl)methoxy]-7H-purin-2-amine |
|---|
| Molecular Formula | C12H10ClN5O |
|---|---|
| Molecular Weight | 275.69400 |
| Exact Mass | 275.05700 |
| PSA | 90.44000 |
| LogP | 2.09760 |
| InChIKey | PQEFDHGUTNYNMO-UHFFFAOYSA-N |
| SMILES | Nc1nc(OCc2ccc(Cl)cc2)c2[nH]cnc2n1 |
|
Name: In vitro inhibition of human alkyl transferase in HT-29 cell-free extracts.
Source: ChEMBL
Target: Methylated-DNA--protein-cysteine methyltransferase
External Id: CHEMBL642174
|
|
Name: Inhibitory activity against alkyl transferase in HT-29 cells
Source: ChEMBL
Target: Methylated-DNA--protein-cysteine methyltransferase
External Id: CHEMBL642176
|
Total 2, Current Page 1 of 1
1