Lascivol structure
|
Common Name | Lascivol | ||
|---|---|---|---|---|
| CAS Number | 129421-88-1 | Molecular Weight | 372.41300 | |
| Density | 1.26g/cm3 | Boiling Point | 662.4ºC at 760 mmHg | |
| Molecular Formula | C17H28N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.4ºC | |
Use of LascivolLascivol is a bitter compound isolated from Tricholoma species[1]. |
| Name | (2S)-5-amino-2-[[(1R,2S)-1-[(3S,5S)-3,5-dimethoxy-2-methyl-6-oxocyclohexen-1-yl]-1-hydroxypropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Lascivol is a bitter compound isolated from Tricholoma species[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 662.4ºC at 760 mmHg |
| Molecular Formula | C17H28N2O7 |
| Molecular Weight | 372.41300 |
| Flash Point | 354.4ºC |
| Exact Mass | 372.19000 |
| PSA | 149.17000 |
| LogP | 0.90400 |
| Vapour Pressure | 2.3E-20mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | WVTLJZPVEOVDLM-VSBZFQJLSA-N |
| SMILES | COC1CC(OC)C(C)=C(C(O)C(C)NC(=O)CCC(N)C(=O)O)C1=O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Lascivol |