IMpurity A of Tacalcitol structure
|
Common Name | IMpurity A of Tacalcitol | ||
|---|---|---|---|---|
| CAS Number | 1294517-97-7 | Molecular Weight | 416.637 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 565.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H44O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.4±24.7 °C | |
| Name | IMpurity A of Tacalcitol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 565.0±50.0 °C at 760 mmHg |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.637 |
| Flash Point | 238.4±24.7 °C |
| Exact Mass | 416.329041 |
| LogP | 6.12 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | BJYLYJCXYAMOFT-TZGGOSDNSA-N |
| SMILES | C=C1C(=CC=C2CCCC3(C)C2CCC3C(C)CCC(O)C(C)C)CC(O)CC1O |
| 1,3-Cyclohexanediol, 4-methylene-5-[(2E)-2-[(1R,3aS,7aR)-octahydro-1-[(1R,4R)-4-hydroxy-1,5-dimethylhexyl]-7a-methyl-4H-inden-4-ylidene]ethylidene]-, (1R,3S,5E)- |
| (1S,3R,5E,7E,24R)-9,10-Secocholesta-5,7,10-triene-1,3,24-triol |