Methyl 2,4-dihydroxypyrimidine-5-carboxylate structure
|
Common Name | Methyl 2,4-dihydroxypyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 129487-92-9 | Molecular Weight | 234.294 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 385.2±41.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7±27.6 °C | |
| Name | 5-Amino-2,3-dihydro-indole-1-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.2±41.0 °C at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.294 |
| Flash Point | 186.7±27.6 °C |
| Exact Mass | 234.136826 |
| PSA | 55.56000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | JSNLQWAGJJGYOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(N)ccc21 |
| HS Code | 2933990090 |
|---|
|
~99%
Methyl 2,4-dihy... CAS#:129487-92-9 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH Patent: WO2008/113760 A2, 2008 ; Location in patent: Page/Page column 92 ; WO 2008/113760 A2 |
|
~99%
Methyl 2,4-dihy... CAS#:129487-92-9 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH Patent: WO2009/16119 A1, 2009 ; Location in patent: Page/Page column 54 ; WO 2009/016119 A1 |
|
~%
Methyl 2,4-dihy... CAS#:129487-92-9 |
| Literature: US2011/319394 A1, ; |
|
~%
Methyl 2,4-dihy... CAS#:129487-92-9 |
| Literature: US2011/319394 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-1-carboxylic acid, 5-amino-2,3-dihydro-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 5-amino-1-indolinecarboxylate |
| 5-Amino-1-Boc-2,3-dihydroindole |
| tert-butyl 5-amino-2,3-dihydroindole-1-carboxylate |