2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride
Modify Date: 2025-08-24 09:46:35
![2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride Structure](https://www.chemsrc.com/extcaspic/300/129504-49-0.png)
2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride structure
|
Common Name | 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 129504-49-0 | Molecular Weight | 257.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10ClF2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10ClF2NO2S |
|---|---|
| Molecular Weight | 257.69 |
| InChIKey | CYTPPEQQUJYXBQ-UHFFFAOYSA-N |
| SMILES | Cl.O=S(=O)(F)CCNc1ccc(F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride? |
| A: CAS number of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride is 129504-49-0. |
| Q: What is the English name of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride? |
| A: The English name of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride is 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride. |
| Q: What is the InChIKey of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride? |
| A: InChIKey of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride is CYTPPEQQUJYXBQ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 129504-49-0? |
| A: Chinese name of 129504-49-0 is 129504-49-0. |
| Q: What is the molecular weight of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride? |
| A: Molecular weight of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride is 257.69. |
| Q: What is the SMILES notation of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride? |
| A: SMILES notation of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride is Cl.O=S(=O)(F)CCNc1ccc(F)cc1. |
| Q: What is the molecular formula of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride? |
| A: Molecular formula of 2-[(4-Fluorophenyl)amino]ethane-1-sulfonyl fluoride hydrochloride is C8H10ClF2NO2S. |