Ethyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-thioglucopyranoside structure
|
Common Name | Ethyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-thioglucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 129519-28-4 | Molecular Weight | 441.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H23NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-[(2S,3R,4S)-2-(ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran-3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name), with the common name Ethyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-thioglucopyranoside, has a CAS number of 129519-28-4, a molecular formula of C23H23NO6S, and a molecular weight of 441.5. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H23NO6S |
|---|---|
| Molecular Weight | 441.5 |
| Exact Mass | 441.12460863 |
| PSA | 112.37000 |
| LogP | 0.76790 |
| InChIKey | NKWDXXRTRBDFKO-FHHHWWIASA-N |
| SMILES | CCS[C@H]1[C@@H]([C@H]([C@H]2[C@H](O1)COC(O2)C3=CC=CC=C3)O)N4C(=O)C5=CC=CC=C5C4=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 4,6-di-O-acetyl-2,3-dideoxy-D-er-hexenopyranoside |
| 2-((6S,7R,8aS)-6-ethylsulfanyl-8-hydroxy-2-phenyl-hexahydro-pyrano[3,2-d][1,3]dioxin-7-yl)-isoindole-1,3-dione |
| (+)-ETHYL-4,6-DI-O-ACETYL-2,3-DIDEOXYA-D |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name)? |
| A: LogP of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) is 0.76790. |
| Q: What is the SMILES notation of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name)? |
| A: SMILES notation of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) is CCS[C@H]1[C@@H]([C@H]([C@H]2[C@H](O1)COC(O2)C3=CC=CC=C3)O)N4C(=O)C5=CC=CC=C5C4=O. |
| Q: What is the molecular weight of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name)? |
| A: Molecular weight of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) is 441.5. |
| Q: What is the CAS number of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name)? |
| A: CAS number of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) is 129519-28-4. |
| Q: What English synonyms does 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) have? |
| A: English synonyms of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name): ethyl 4,6-di-O-acetyl-2,3-dideoxy-D-er-hexenopyranoside, 2-((6S,7R,8aS)-6-ethylsulfanyl-8-hydroxy-2-phenyl-hexahydro-pyrano[3,2-d][1,3]dioxin-7-yl)-isoindole-1,3-dione, (+)-ETHYL-4,6-DI-O-ACETYL-2,3-DIDEOXYA-D. |
| Q: What is the molecular formula of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name)? |
| A: Molecular formula of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) is C23H23NO6S. |
| Q: What is the InChIKey of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name)? |
| A: InChIKey of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) is NKWDXXRTRBDFKO-FHHHWWIASA-N. |
| Q: What are the upstream materials of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name)? |
| A: Related upstream materials(CAS) of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name): 10022-13-6;1125-88-8;75-08-1;99409-32-2;100-52-7. |
| Q: What is the English name of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name)? |
| A: The English name of 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name) is 2-[(2S,3R,4S)-2-(Ethylsulfanyl)-4,6-dihydroxytetrahydro-2H-pyran- 3-yl]-1H-isoindole-1,3(2H)-dione (non-preferred name). |
| Q: What is the Chinese name of 129519-28-4? |
| A: Chinese name of 129519-28-4 is 129519-28-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |