(Phenylac1,D-Tyr(Et)2,Lys6,Arg8,des-Gly9)-Vasopressin trifluoroacetate salt structure
|
Common Name | (Phenylac1,D-Tyr(Et)2,Lys6,Arg8,des-Gly9)-Vasopressin trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 129520-65-6 | Molecular Weight | 1097.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C54H76N14O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (Phenylac1,D-Tyr(Et)2,Lys6,Arg8,des-Gly9)-Vasopressin trifluoroacetate salt(Phenylac1,D-Tyr(Et)2,Lys6,Arg8,des-Gly9)-Vasopressin is a potent vasopressin V1 receptor (VP V1R) antagonist. (Phenylac1,D-Tyr(Et)2,Lys6,Arg8,des-Gly9)-Vasopressin significantly decreases the mean arterial pressure (MAP) in rats[1]. |
| Name | (Phenylac1,D-Tyr(Et)2,Lys6,Arg8,des-Gly9)-Vasopressin |
|---|---|
| Synonym | More Synonyms |
| Description | (Phenylac1,D-Tyr(Et)2,Lys6,Arg8,des-Gly9)-Vasopressin is a potent vasopressin V1 receptor (VP V1R) antagonist. (Phenylac1,D-Tyr(Et)2,Lys6,Arg8,des-Gly9)-Vasopressin significantly decreases the mean arterial pressure (MAP) in rats[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C54H76N14O11 |
|---|---|
| Molecular Weight | 1097.27000 |
| Exact Mass | 1096.58000 |
| PSA | 421.33000 |
| LogP | 4.30690 |
| InChIKey | PBPXAIJQDPORTG-ZRBRQIMBSA-N |
| SMILES | CCOc1ccc(CC(NC(=O)Cc2ccccc2)C(=O)NC(Cc2ccccc2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(CCCCN)C(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(N)=O)cc1 |
| PHENYLAC-D-TYR(ET)-PHE-GLN-ASN-LYS-PRO-ARG-NH2 |
| Phaa-D-Tyr(Et)-Phe-Gln-Asn-Lys-Pro-Arg-NH2 |