Methyl 2,3,4-tri-O-acetyl-β-D-thiogalactopyranosiduronic acid methyl ester structure
|
Common Name | Methyl 2,3,4-tri-O-acetyl-β-D-thiogalactopyranosiduronic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 129541-34-0 | Molecular Weight | 364.36800 | |
| Density | 1.31g/cm3 | Boiling Point | 418ºC at 760 mmHg | |
| Molecular Formula | C14H20O9S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 194.7ºC | |
| Name | Methyl 2,3,4-tri-O-acetyl-β-D-thiogalactopyranosiduronic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 418ºC at 760 mmHg |
| Molecular Formula | C14H20O9S |
| Molecular Weight | 364.36800 |
| Flash Point | 194.7ºC |
| Exact Mass | 364.08300 |
| PSA | 139.73000 |
| LogP | 0.04240 |
| Vapour Pressure | 3.39E-07mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | HHAWIPPOHLEARU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1OC(SC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| methyl 3,4,5-triacetyloxy-6-methylsulfanyloxane-2-carboxylate |